You're awesome. Have a mirror on us.
We love Linux, privacy, fast and affordable internet access, and working to fulfill our mission of internet freedom for all.
![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[DIR]](/icons/folder.gif){kind=icon} | i2c-tools/ | 2024-11-15 04:53 | - | |
| i2masschroq/ | 2023-09-12 18:59 | - | |
| i2p/ | 2022-07-23 01:03 | - | |
| i2pd/ | 2024-07-27 18:01 | - | |
| i2util/ | 2024-02-17 12:02 | - | |
| i3-wm/ | 2024-11-07 23:40 | - | |
| i3blocks/ | 2020-07-10 14:52 | - | |
| i3lock-fancy/ | 2020-04-02 22:43 | - | |
| i3lock/ | 2024-05-09 05:20 | - | |
| i3pystatus/ | 2024-05-03 09:35 | - | |
| i3status/ | 2024-10-31 23:49 | - | |
| i7z/ | 2022-06-06 04:34 | - | |
| i8c/ | 2018-06-22 08:13 | - | |
| i8kutils/ | 2024-12-27 16:39 | - | |
| i18nspector/ | 2023-10-26 15:14 | - | |
| i810switch/ | 2018-04-04 01:59 | - | |
| iagno/ | 2025-01-15 18:33 | - | |
| iaito/ | 2024-12-03 17:00 | - | |
| iamcli/ | 2015-04-26 11:03 | - | |
| iannix/ | 2024-04-06 06:48 | - | |
| iapws/ | 2024-05-07 10:44 | - | |
| iaqualink/ | 2024-11-16 16:44 | - | |
| iat/ | 2022-12-29 16:09 | - | |
| iausofa-c/ | 2018-06-22 08:13 | - | |
| iaxmodem/ | 2021-05-06 17:09 | - | |
| ibacm/ | 2020-07-10 14:52 | - | |
| ibam/ | 2020-03-22 13:01 | - | |
| ibid/ | 2017-04-29 00:10 | - | |
| ibm-3270/ | 2025-02-04 05:24 | - | |
| ibniz/ | 2018-04-04 01:59 | - | |
| ibod/ | 2018-04-04 02:00 | - | |
| ibsim/ | 2024-04-22 09:59 | - | |
| ibuffer-projectile/ | 2024-07-25 11:14 | - | |
| ibuffer-vc/ | 2024-07-25 11:14 | - | |
| ibus-anthy/ | 2024-05-16 07:59 | - | |
| ibus-array/ | 2024-11-01 01:23 | - | |
| ibus-avro/ | 2024-05-02 19:39 | - | |
| ibus-braille/ | 2024-01-12 05:11 | - | |
| ibus-cangjie/ | 2025-01-11 10:45 | - | |
| ibus-client-clutter/ | 2024-04-11 11:48 | - | |
| ibus-el/ | 2015-04-27 09:00 | - | |
| ibus-googlepinyin/ | 2015-04-27 09:00 | - | |
| ibus-input-pad/ | 2024-04-06 06:48 | - | |
| ibus-keyman/ | 2022-07-23 20:42 | - | |
| ibus-kkc/ | 2024-05-16 09:29 | - | |
| ibus-kmfl/ | 2024-04-03 12:19 | - | |
| ibus-libpinyin/ | 2018-02-02 16:16 | - | |
| ibus-libthai/ | 2025-01-31 12:48 | - | |
| ibus-libzhuyin/ | 2024-04-06 06:48 | - | |
| ibus-pinyin/ | 2024-07-15 07:34 | - | |
| ibus-qt/ | 2020-07-10 14:52 | - | |
| ibus-rime/ | 2025-01-30 05:09 | - | |
| ibus-skk/ | 2024-04-06 06:48 | - | |
| ibus-sunpinyin/ | 2024-04-03 12:19 | - | |
| ibus-table-chinese/ | 2024-05-02 18:55 | - | |
| ibus-table-extraphrase/ | 2024-05-09 05:20 | - | |
| ibus-table-others/ | 2024-11-04 04:05 | - | |
| ibus-tegaki/ | 2015-12-04 00:19 | - | |
| ibus-typing-booster/ | 2025-02-05 22:31 | - | |
| ibus-xkbc/ | 2015-04-26 05:12 | - | |
| ibus-zhuyin/ | 2024-07-09 12:01 | - | |
| ibus/ | 2025-02-04 11:00 | - | |
| ibutils/ | 2024-04-22 09:59 | - | |
| ical2html/ | 2024-04-04 12:15 | - | |
| icb-utils/ | 2022-07-23 20:42 | - | |
| icdiff/ | 2025-02-01 16:53 | - | |
| ice-builder-gradle/ | 2022-11-30 09:39 | - | |
| icebreaker/ | 2021-10-20 21:49 | - | |
| icecast2/ | 2024-04-05 00:45 | - | |
| icecc-monitor/ | 2024-04-06 06:48 | - | |
| icecc/ | 2024-04-06 11:46 | - | |
| icecream-sundae/ | 2024-04-06 06:48 | - | |
| icecream/ | 2024-05-19 04:27 | - | |
| icedtea-web/ | 2024-07-13 16:19 | - | |
| iceoryx/ | 2024-05-06 06:23 | - | |
| ices2/ | 2024-04-05 06:13 | - | |
| icewm-themes/ | 2012-05-11 11:34 | - | |
| icewm/ | 2024-11-17 06:25 | - | |
| icheck/ | 2025-01-02 16:46 | - | |
| icicles/ | 2016-11-01 01:15 | - | |
| icinga-php-library/ | 2024-08-07 12:01 | - | |
| icinga-php-thirdparty/ | 2024-01-12 17:09 | - | |
| icinga-web/ | 2018-06-22 08:13 | - | |
| icinga/ | 2020-12-29 15:34 | - | |
| icinga2/ | 2025-02-06 15:18 | - | |
| icingadb-web/ | 2024-08-07 12:01 | - | |
| icingadb/ | 2024-12-18 16:51 | - | |
| icingaweb2-module-audit/ | 2024-05-02 19:39 | - | |
| icingaweb2-module-boxydash/ | 2024-05-02 19:39 | - | |
| icingaweb2-module-businessprocess/ | 2024-07-04 06:07 | - | |
| icingaweb2-module-cube/ | 2024-07-04 06:07 | - | |
| icingaweb2-module-director/ | 2024-05-02 20:30 | - | |
| icingaweb2-module-eventdb/ | 2024-07-05 17:52 | - | |
| icingaweb2-module-fileshipper/ | 2024-05-02 20:30 | - | |
| icingaweb2-module-generictts/ | 2024-05-02 20:30 | - | |
| icingaweb2-module-graphite/ | 2024-05-02 20:30 | - | |
| icingaweb2-module-idoreports/ | 2024-07-13 17:51 | - | |
| icingaweb2-module-incubator/ | 2024-05-02 20:30 | - | |
| icingaweb2-module-ipl/ | 2021-01-31 16:15 | - | |
| icingaweb2-module-map/ | 2024-07-12 11:35 | - | |
| icingaweb2-module-metapackages/ | 2022-07-26 16:24 | - | |
| icingaweb2-module-nagvis/ | 2024-05-02 20:30 | - | |
| icingaweb2-module-pdfexport/ | 2024-07-13 17:51 | - | |
| icingaweb2-module-pnp/ | 2024-05-02 20:30 | - | |
| icingaweb2-module-reactbundle/ | 2022-07-23 20:42 | - | |
| icingaweb2-module-reporting/ | 2024-07-04 06:07 | - | |
| icingaweb2-module-statusmap/ | 2024-05-02 20:30 | - | |
| icingaweb2-module-toplevelview/ | 2024-10-31 14:02 | - | |
| icingaweb2-module-x509/ | 2024-05-02 20:30 | - | |
| icingaweb2/ | 2024-11-13 17:24 | - | |
| icli/ | 2014-10-24 13:20 | - | |
| icmake/ | 2025-02-06 11:40 | - | |
| icmpinfo/ | 2024-02-17 12:02 | - | |
| icmptx/ | 2024-12-16 04:02 | - | |
| icmpush/ | 2025-01-21 23:04 | - | |
| icoextract/ | 2024-05-02 20:30 | - | |
| icom/ | 2024-07-07 22:55 | - | |
| icon-naming-utils/ | 2022-07-23 20:42 | - | |
| icon-slicer/ | 2020-04-04 04:58 | - | |
| icon/ | 2024-11-08 11:23 | - | |
| icontool/ | 2024-02-17 11:15 | - | |
| icoutils/ | 2024-11-01 01:23 | - | |
| icu-ext/ | 2025-01-10 16:48 | - | |
| icu-le-hb/ | 2022-07-23 20:42 | - | |
| icu/ | 2023-03-17 00:15 | - | |
| icu4j-4.2/ | 2020-07-10 14:52 | - | |
| icu4j-4.4/ | 2021-02-08 10:24 | - | |
| icu4j-49/ | 2018-03-29 04:39 | - | |
| icu4j/ | 2023-10-26 15:13 | - | |
| icu74/ | 2025-01-18 04:53 | - | |
| id-utils/ | 2020-05-25 17:13 | - | |
| id3/ | 2024-12-14 19:15 | - | |
| id3lib3.8.3/ | 2024-04-18 16:31 | - | |
| id3ren/ | 2021-12-15 15:39 | - | |
| id3tool/ | 2024-11-01 01:23 | - | |
| id3v2/ | 2022-11-20 21:50 | - | |
| idba/ | 2022-11-07 10:59 | - | |
| iddawc/ | 2024-04-06 06:48 | - | |
| ideep/ | 2025-01-23 09:53 | - | |
| ident2/ | 2024-07-24 23:04 | - | |
| identicurse/ | 2020-04-19 23:14 | - | |
| identify/ | 2025-01-23 23:01 | - | |
| identity4c/ | 2024-04-05 00:45 | - | |
| idesk/ | 2024-06-08 05:33 | - | |
| ideviceinstaller/ | 2024-11-28 16:49 | - | |
| idevicerestore/ | 2024-11-22 17:26 | - | |
| idl-font-lock-el/ | 2022-07-23 20:42 | - | |
| idlastro/ | 2024-10-31 14:02 | - | |
| idle3-tools/ | 2023-11-27 16:09 | - | |
| idlestat/ | 2024-01-12 09:56 | - | |
| idm-console-framework/ | 2021-10-19 11:32 | - | |
| ido-gtk2/ | 2019-09-04 23:16 | - | |
| ido-ubiquitous/ | 2024-07-25 11:14 | - | |
| ido-vertical-mode/ | 2024-07-25 11:14 | - | |
| ido/ | 2024-04-06 06:48 | - | |
| idseq-bench/ | 2022-07-23 20:42 | - | |
| idzebra/ | 2024-06-25 11:51 | - | |
| ie7-js/ | 2014-07-31 16:18 | - | |
| iec16022/ | 2024-04-08 03:16 | - | |
| iedit/ | 2024-07-25 11:14 | - | |
| ieee-data/ | 2016-11-03 06:09 | - | |
| iem-plugin-suite/ | 2024-04-06 06:48 | - | |
| iep/ | 2015-10-24 17:16 | - | |
| ifcplusplus/ | 2024-05-31 20:58 | - | |
| ifd-gempc/ | 2024-07-05 12:16 | - | |
| ifenslave/ | 2020-07-30 17:14 | - | |
| ifetch-tools/ | 2022-07-23 20:42 | - | |
| ifhp/ | 2024-01-27 22:05 | - | |
| ifile/ | 2024-05-09 05:20 | - | |
| ifmail/ | 2025-01-15 05:07 | - | |
| ifmetric/ | 2020-12-29 15:34 | - | |
| ifpgui/ | 2018-04-04 02:00 | - | |
| ifplugd/ | 2023-12-18 17:31 | - | |
| ifrench-gut/ | 2024-05-09 00:34 | - | |
| ifrench/ | 2022-07-23 20:42 | - | |
| ifrit/ | 2020-07-14 07:44 | - | |
| ifscheme/ | 2024-10-02 11:46 | - | |
| ifstat/ | 2024-04-06 06:48 | - | |
| iftop/ | 2024-04-05 00:45 | - | |
| ifupdown-extra/ | 2024-10-31 14:02 | - | |
| ifupdown-multi/ | 2020-10-29 04:34 | - | |
| ifupdown-ng/ | 2024-08-05 06:12 | - | |
| ifupdown-scripts-zg2/ | 2016-11-01 01:15 | - | |
| ifupdown/ | 2024-05-09 00:34 | - | |
| ifupdown2/ | 2021-03-18 17:18 | - | |
| ifuse/ | 2024-08-26 17:41 | - | |
| igaelic/ | 2021-01-02 16:28 | - | |
| igal2/ | 2022-07-23 20:42 | - | |
| igdiscover/ | 2023-05-01 18:52 | - | |
| igerman98/ | 2024-10-31 12:19 | - | |
| igmpproxy/ | 2021-01-28 10:09 | - | |
| ignition-cmake/ | 2024-04-22 11:53 | - | |
| ignition-cmake2/ | 2020-04-03 01:03 | - | |
| ignition-common/ | 2024-04-22 11:53 | - | |
| ignition-common3/ | 2024-01-10 23:31 | - | |
| ignition-fuel-tools/ | 2024-04-22 11:53 | - | |
| ignition-fuel-tools4/ | 2023-02-05 22:39 | - | |
| ignition-gazebo/ | 2024-03-30 05:52 | - | |
| ignition-gui/ | 2024-03-25 17:45 | - | |
| ignition-launch/ | 2024-03-30 05:52 | - | |
| ignition-math/ | 2024-04-22 11:53 | - | |
| ignition-math2/ | 2020-07-10 14:52 | - | |
| ignition-math4/ | 2020-12-29 15:34 | - | |
| ignition-msgs/ | 2024-04-22 11:53 | - | |
| ignition-msgs5/ | 2024-01-10 23:31 | - | |
| ignition-physics/ | 2024-04-22 11:53 | - | |
| ignition-plugin/ | 2024-04-22 11:53 | - | |
| ignition-rendering/ | 2024-03-24 17:41 | - | |
| ignition-sensors/ | 2024-03-25 17:45 | - | |
| ignition-tools/ | 2024-04-22 11:53 | - | |
| ignition-transport/ | 2024-04-22 11:53 | - | |
| ignition-transport8/ | 2024-01-10 23:31 | - | |
| ignition-utils/ | 2023-08-10 10:44 | - | |
| ignition/ | 2024-11-20 16:52 | - | |
| ignore-me/ | 2021-04-01 20:48 | - | |
| igor/ | 2024-09-11 17:53 | - | |
| igor2/ | 2024-12-07 16:07 | - | |
| igraph/ | 2025-01-11 22:53 | - | |
| igstk/ | 2016-11-01 01:15 | - | |
| igtf-policy-bundle/ | 2024-12-18 16:53 | - | |
| igv/ | 2024-10-31 14:02 | - | |
| ii-esu/ | 2022-08-24 11:34 | - | |
| ii/ | 2024-05-28 05:51 | - | |
| iio-sensor-proxy/ | 2020-07-10 14:52 | - | |
| iipimage/ | 2024-04-07 05:50 | - | |
| iir1/ | 2024-11-02 05:15 | - | |
| iirish/ | 2024-04-08 10:56 | - | |
| iisemulator/ | 2023-10-26 15:13 | - | |
| iitalian/ | 2023-10-28 05:45 | - | |
| iitii/ | 2024-12-14 19:15 | - | |
| ikarus/ | 2022-07-23 20:42 | - | |
| ike-scan/ | 2024-08-02 04:47 | - | |
| ike/ | 2018-01-23 01:08 | - | |
| ikeyd/ | 2016-10-31 05:45 | - | |
| ikiwiki-hosting/ | 2024-06-17 09:29 | - | |
| ikiwiki/ | 2025-01-08 16:07 | - | |
| ikvm/ | 2017-04-05 23:44 | - | |
| ikvswitch/ | 2025-02-06 10:16 | - | |
| ilisp/ | 2023-07-04 18:10 | - | |
| illustrate/ | 2021-10-21 08:53 | - | |
| ilmbase/ | 2022-07-23 23:32 | - | |
| ilohamail/ | 2016-10-31 18:15 | - | |
| ilorest/ | 2025-01-29 16:52 | - | |
| im-switch/ | 2015-04-27 08:59 | - | |
| im/ | 2021-01-01 21:31 | - | |
| ima-evm-utils/ | 2024-11-16 21:37 | - | |
| image-analyzer/ | 2024-06-02 17:46 | - | |
| image-factory/ | 2023-05-01 18:52 | - | |
| imageindex/ | 2025-01-03 22:06 | - | |
| imageinfo/ | 2024-12-02 16:48 | - | |
| imagej/ | 2023-11-27 15:30 | - | |
| imagemagick/ | 2025-01-21 16:49 | - | |
| imagesloaded/ | 2014-06-25 17:25 | - | |
| imagetooth/ | 2024-02-23 09:08 | - | |
| imagevis3d/ | 2020-07-14 07:44 | - | |
| imagination/ | 2024-04-03 12:19 | - | |
| imanx/ | 2024-04-08 10:56 | - | |
| imap-tools/ | 2022-04-29 23:50 | - | |
| imapcopy/ | 2024-02-17 11:16 | - | |
| imapfilter/ | 2024-04-06 06:48 | - | |
| imaprowl/ | 2024-04-02 12:16 | - | |
| imaptool/ | 2024-07-03 18:36 | - | |
| imath/ | 2025-01-30 11:13 | - | |
| imbalanced-learn/ | 2024-10-31 14:02 | - | |
| imdb-tools/ | 2016-10-31 18:15 | - | |
| imdbpy/ | 2022-07-23 20:42 | - | |
| imediff/ | 2025-02-06 11:03 | - | |
| imediff2/ | 2022-07-23 20:42 | - | |
| imenu-list/ | 2024-07-25 11:14 | - | |
| imexam/ | 2024-01-13 05:13 | - | |
| img2pdf/ | 2024-01-10 11:14 | - | |
| imgp/ | 2023-10-26 15:13 | - | |
| imgsizer/ | 2024-10-31 14:02 | - | |
| imgui/ | 2024-01-23 16:10 | - | |
| imgvtopgm/ | 2024-04-06 06:48 | - | |
| imhangul-common/ | 2015-04-26 05:11 | - | |
| imhangul/ | 2015-12-04 16:16 | - | |
| imhangul3/ | 2018-01-22 00:51 | - | |
| iminuit/ | 2024-11-17 10:43 | - | |
| iml/ | 2024-05-09 05:20 | - | |
| imlib2/ | 2025-01-05 17:57 | - | |
| immer/ | 2023-10-29 17:38 | - | |
| imms/ | 2018-01-22 00:51 | - | |
| impacket/ | 2024-11-20 05:03 | - | |
| impass/ | 2025-01-09 23:03 | - | |
| importlab/ | 2024-05-02 20:30 | - | |
| importlib-resources/ | 2022-07-23 18:06 | - | |
| importmagic/ | 2025-01-10 16:02 | - | |
| impose+/ | 2024-10-31 14:02 | - | |
| imposm-parser/ | 2020-07-14 07:44 | - | |
| imposm/ | 2020-07-14 07:44 | - | |
| impress.js/ | 2021-12-04 10:14 | - | |
| impressive-display/ | 2022-11-22 16:37 | - | |
| impressive/ | 2024-01-05 17:00 | - | |
| imsniff/ | 2016-10-31 18:15 | - | |
| imspector/ | 2016-03-10 04:27 | - | |
| imsprog/ | 2025-01-21 16:49 | - | |
| imv/ | 2025-01-10 16:48 | - | |
| imview-doc/ | 2015-04-30 06:20 | - | |
| imview/ | 2024-04-06 06:48 | - | |
| imvirt/ | 2024-01-13 11:07 | - | |
| imwheel/ | 2024-04-18 16:31 | - | |
| imx-code-signing-tool/ | 2024-04-06 06:48 | - | |
| imx-usb-loader/ | 2022-11-20 16:54 | - | |
| in-n-out/ | 2024-05-11 16:49 | - | |
| in-place/ | 2024-12-07 16:07 | - | |
| in-toto-golang/ | 2024-06-28 17:57 | - | |
| in-toto/ | 2024-01-10 11:14 | - | |
| inadyn/ | 2024-04-06 06:48 | - | |
| inchi/ | 2025-01-21 10:59 | - | |
| incidenceeditor/ | 2024-12-19 22:53 | - | |
| incron/ | 2023-01-29 04:31 | - | |
| incus/ | 2025-01-27 05:13 | - | |
| indelible/ | 2023-12-30 15:47 | - | |
| indexed-gzip/ | 2025-02-05 10:52 | - | |
| indi-aagcloudwatcher-ng/ | 2025-01-13 10:52 | - | |
| indi-aok/ | 2025-01-13 10:52 | - | |
| indi-apogee/ | 2025-01-13 10:52 | - | |
| indi-armadillo-platypus/ | 2025-01-13 10:52 | - | |
| indi-astrolink4/ | 2025-01-13 10:52 | - | |
| indi-astromechfoc/ | 2025-01-13 10:52 | - | |
| indi-avalon/ | 2025-01-13 10:52 | - | |
| indi-beefocus/ | 2025-01-13 10:52 | - | |
| indi-bresserexos2/ | 2025-01-13 10:52 | - | |
| indi-dreamfocuser/ | 2025-01-13 10:52 | - | |
| indi-dsi/ | 2025-01-13 10:52 | - | |
| indi-eqmod/ | 2025-01-13 10:52 | - | |
| indi-ffmv/ | 2025-01-13 10:52 | - | |
| indi-fli/ | 2025-01-13 10:52 | - | |
| indi-gige/ | 2025-01-13 10:52 | - | |
| indi-gphoto/ | 2025-01-13 10:52 | - | |
| indi-gpsd/ | 2025-01-13 10:52 | - | |
| indi-gpsnmea/ | 2025-01-13 10:52 | - | |
| indi-limesdr/ | 2025-01-13 10:52 | - | |
| indi-maxdomeii/ | 2025-01-13 10:52 | - | |
| indi-mgen/ | 2025-01-13 10:52 | - | |
| indi-nexdome/ | 2025-01-13 10:52 | - | |
| indi-nightscape/ | 2025-01-13 10:52 | - | |
| indi-orion-ssg3/ | 2025-01-13 10:52 | - | |
| indi-rtklib/ | 2025-01-13 10:52 | - | |
| indi-sbig/ | 2020-07-10 14:52 | - | |
| indi-shelyak/ | 2025-01-13 10:52 | - | |
| indi-spectracyber/ | 2025-01-13 10:52 | - | |
| indi-starbook-ten/ | 2025-01-13 10:52 | - | |
| indi-starbook/ | 2025-01-13 10:52 | - | |
| indi-sx/ | 2025-01-13 10:52 | - | |
| indi-talon6/ | 2025-01-13 10:52 | - | |
| indi-webcam/ | 2025-01-13 10:52 | - | |
| indi-weewx-json/ | 2025-01-13 10:52 | - | |
| indi/ | 2025-01-13 10:52 | - | |
| indicator-applet/ | 2024-10-06 13:40 | - | |
| indicator-application-gtk2/ | 2018-04-05 10:23 | - | |
| indicator-application/ | 2024-04-06 06:48 | - | |
| indicator-appmenu/ | 2024-04-06 06:48 | - | |
| indicator-bluetooth/ | 2024-04-06 06:48 | - | |
| indicator-china-weather/ | 2024-04-06 06:48 | - | |
| indicator-cpufreq/ | 2023-06-22 10:25 | - | |
| indicator-datetime/ | 2024-04-06 06:48 | - | |
| indicator-display/ | 2018-06-22 08:13 | - | |
| indicator-keyboard/ | 2024-10-02 04:52 | - | |
| indicator-keylock/ | 2018-01-22 00:51 | - | |
| indicator-location/ | 2018-06-22 08:13 | - | |
| indicator-messages/ | 2024-04-12 17:47 | - | |
| indicator-multiload/ | 2024-04-10 17:50 | - | |
| indicator-network-prompt/ | 2015-04-28 11:02 | - | |
| indicator-network/ | 2020-07-10 23:17 | - | |
| indicator-notifications/ | 2024-04-06 06:48 | - | |
| indicator-power/ | 2024-04-12 17:47 | - | |
| indicator-printers/ | 2024-04-06 06:48 | - | |
| indicator-sensors/ | 2024-04-06 06:48 | - | |
| indicator-session/ | 2025-01-31 19:58 | - | |
| indicator-sound-gtk2/ | 2018-06-22 08:13 | - | |
| indicator-sound/ | 2024-04-15 05:45 | - | |
| indicator-transfer-buteo/ | 2016-08-19 03:00 | - | |
| indicator-transfer/ | 2018-06-22 12:01 | - | |
| indie-wiki-buddy/ | 2024-11-01 01:06 | - | |
| indigo/ | 2024-04-22 05:45 | - | |
| indiv-screenlets/ | 2015-04-26 05:11 | - | |
| industrialtango-theme/ | 2011-09-20 01:44 | - | |
| inetsim/ | 2022-07-23 20:42 | - | |
| inetutils/ | 2024-07-11 15:15 | - | |
| infernal/ | 2024-12-17 16:48 | - | |
| infiniband-diags/ | 2020-12-29 15:34 | - | |
| infinipath-psm/ | 2024-04-23 11:54 | - | |
| inflection/ | 2022-05-03 22:29 | - | |
| influxdb-python/ | 2024-11-19 05:01 | - | |
| influxdb/ | 2024-11-20 16:52 | - | |
| infnoise/ | 2023-02-17 09:49 | - | |
| info-beamer/ | 2022-07-22 17:19 | - | |
| info2man/ | 2022-11-15 16:12 | - | |
| info2www/ | 2024-11-13 04:47 | - | |
| infomas-asl/ | 2023-06-12 17:16 | - | |
| infon-devel/ | 2015-04-30 06:20 | - | |
| infon/ | 2020-04-04 18:18 | - | |
| inform-mode/ | 2024-07-26 05:20 | - | |
| inform6-compiler/ | 2022-11-22 04:10 | - | |
| inform6-library/ | 2022-04-29 19:25 | - | |
| inheritenv/ | 2024-07-25 11:14 | - | |
| inhomog/ | 2024-07-30 01:11 | - | |
| ini4j/ | 2021-01-20 16:16 | - | |
| inifile/ | 2022-07-23 20:42 | - | |
| iniparser/ | 2021-03-02 09:48 | - | |
| init-select/ | 2014-11-04 04:26 | - | |
| init-system-helpers/ | 2018-01-23 01:15 | - | |
| initramfs-tools-devices/ | 2020-12-21 03:14 | - | |
| initramfs-tools-ubuntu-touch/ | 2018-06-22 08:13 | - | |
| initsplit-el/ | 2024-07-25 11:14 | - | |
| initz/ | 2021-01-09 09:51 | - | |
| injeqt/ | 2024-04-14 05:45 | - | |
| ink-generator/ | 2024-02-26 04:47 | - | |
| ink/ | 2024-01-10 17:10 | - | |
| inkbird-ble/ | 2024-08-14 06:07 | - | |
| inkscape-open-symbols/ | 2025-01-05 23:28 | - | |
| inkscape-speleo/ | 2020-01-06 04:14 | - | |
| inkscape-survex-export/ | 2020-12-26 03:29 | - | |
| inkscape-textext/ | 2022-11-05 21:04 | - | |
| inkscape/ | 2025-01-24 16:56 | - | |
| inky/ | 2022-10-20 11:23 | - | |
| inn/ | 2024-10-20 05:10 | - | |
| inn2/ | 2025-01-06 05:21 | - | |
| innduct/ | 2024-05-09 05:20 | - | |
| innfeed/ | 2016-10-31 05:45 | - | |
| innoextract/ | 2023-12-19 21:22 | - | |
| ino-headers/ | 2024-11-17 16:12 | - | |
| inosync/ | 2020-12-29 15:34 | - | |
| inotail/ | 2016-11-01 01:15 | - | |
| inoticoming/ | 2020-12-29 15:34 | - | |
| inotify-hookable/ | 2021-04-29 06:39 | - | |
| inotify-info/ | 2025-02-06 04:01 | - | |
| inotify-tools/ | 2024-06-08 11:43 | - | |
| inotifyx/ | 2016-11-01 01:04 | - | |
| input-pad/ | 2024-04-06 06:48 | - | |
| input-remapper/ | 2024-05-26 23:15 | - | |
| input-utils/ | 2024-11-01 01:23 | - | |
| inputlirc/ | 2024-05-09 05:20 | - | |
| inputplug/ | 2024-04-06 06:48 | - | |
| insighttoolkit/ | 2018-01-22 00:51 | - | |
| insighttoolkit4/ | 2024-01-11 11:18 | - | |
| insighttoolkit5/ | 2025-01-28 08:14 | - | |
| insilicoseq/ | 2024-05-02 20:30 | - | |
| inspectrum/ | 2024-04-06 06:48 | - | |
| inspircd/ | 2025-02-06 10:19 | - | |
| install-mimic/ | 2024-12-31 11:17 | - | |
| installation-birthday/ | 2025-01-01 22:48 | - | |
| installation-guide/ | 2022-07-23 05:19 | - | |
| installation-report-generator/ | 2015-04-27 08:59 | - | |
| instaloader/ | 2025-01-31 05:18 | - | |
| instant/ | 2020-07-10 14:52 | - | |
| instaparse-clojure/ | 2021-01-06 16:26 | - | |
| instead/ | 2025-01-11 04:50 | - | |
| insubstantial/ | 2023-05-01 18:52 | - | |
| intake/ | 2024-04-14 05:45 | - | |
| integrit/ | 2024-11-07 02:58 | - | |
| intel-cmt-cat/ | 2025-01-06 11:38 | - | |
| intel-compute-runtime/ | 2025-01-17 11:05 | - | |
| intel-gmmlib/ | 2024-09-29 05:38 | - | |
| intel-gpu-tools/ | 2025-01-19 04:59 | - | |
| intel-graphics-compiler/ | 2024-12-13 05:47 | - | |
| intel-graphics-compiler2/ | 2025-01-22 15:56 | - | |
| intel-hdcp/ | 2024-08-02 06:16 | - | |
| intel-ipsec-mb/ | 2024-12-12 03:05 | - | |
| intel-lpmd/ | 2024-09-25 03:26 | - | |
| intel-media-driver/ | 2025-01-18 23:00 | - | |
| intel-mediasdk/ | 2024-05-28 11:53 | - | |
| intel-opencl-clang/ | 2022-10-17 17:39 | - | |
| intel-processor-trace/ | 2022-07-23 20:42 | - | |
| intel-vaapi-driver/ | 2025-01-15 22:02 | - | |
| intel-vc-intrinsics/ | 2024-08-07 12:01 | - | |
| intel2gas/ | 2024-12-07 23:41 | - | |
| intelhex/ | 2024-05-02 20:30 | - | |
| intellij-annotations/ | 2023-05-01 18:52 | - | |
| intellij-community-idea/ | 2024-07-13 16:19 | - | |
| intellij-java-compatibility/ | 2020-10-29 19:23 | - | |
| intelrdfpmath/ | 2024-01-10 11:14 | - | |
| inteltool/ | 2018-04-04 01:59 | - | |
| intercal/ | 2023-08-16 05:31 | - | |
| interception-tools/ | 2024-01-10 23:31 | - | |
| interchange/ | 2020-07-10 14:52 | - | |
| interface99/ | 2024-05-09 19:10 | - | |
| interimap/ | 2024-12-20 15:52 | - | |
| intervals/ | 2020-08-11 11:16 | - | |
| intervalstorej/ | 2022-11-05 21:04 | - | |
| intlfonts/ | 2024-11-24 03:56 | - | |
| intltool/ | 2020-12-11 22:17 | - | |
| intone/ | 2018-06-20 23:15 | - | |
| intrusive-shared-ptr/ | 2024-11-02 06:16 | - | |
| invada-studio-plugins-lv2/ | 2024-12-03 05:12 | - | |
| invada-studio-plugins/ | 2023-10-28 05:45 | - | |
| invaders/ | 2020-07-21 23:15 | - | |
| inventor/ | 2024-08-18 06:15 | - | |
| invesalius/ | 2024-11-20 05:03 | - | |
| invidtui/ | 2024-07-20 18:00 | - | |
| invokebinder/ | 2024-10-31 14:02 | - | |
| involflt/ | 2024-07-29 12:49 | - | |
| inxi/ | 2025-01-17 22:55 | - | |
| ioapps/ | 2018-01-22 00:51 | - | |
| iodine/ | 2025-02-01 20:54 | - | |
| iog/ | 2022-05-27 16:24 | - | |
| iok/ | 2016-11-01 01:15 | - | |
| ion/ | 2022-11-28 16:37 | - | |
| ionit/ | 2025-01-13 10:07 | - | |
| ioping/ | 2023-01-09 22:04 | - | |
| ioport/ | 2018-01-21 00:02 | - | |
| ioprocess/ | 2020-07-14 07:44 | - | |
| ioquake3/ | 2024-11-06 16:51 | - | |
| iotas/ | 2025-01-29 23:02 | - | |
| iotjs/ | 2022-07-23 20:42 | - | |
| iotop-c/ | 2025-01-13 13:27 | - | |
| iotop/ | 2018-01-23 01:08 | - | |
| ip2host/ | 2021-01-01 21:31 | - | |
| ip4r/ | 2024-11-02 06:16 | - | |
| ipadic/ | 2021-01-07 16:43 | - | |
| ipband/ | 2024-04-05 00:45 | - | |
| ipcalc-ng/ | 2024-05-13 11:40 | - | |
| ipcalc/ | 2023-12-19 16:12 | - | |
| ipcheck/ | 2016-11-02 05:34 | - | |
| ipdb/ | 2024-11-29 22:51 | - | |
| ipe-tools/ | 2025-01-22 16:58 | - | |
| ipe/ | 2024-09-11 17:53 | - | |
| ipe5toxml/ | 2014-02-18 18:28 | - | |
| iperf/ | 2024-12-28 21:19 | - | |
| iperf3/ | 2024-12-28 18:22 | - | |
| ipfm/ | 2024-04-05 00:45 | - | |
| ipgrab/ | 2024-06-30 00:15 | - | |
| ipheth/ | 2024-09-06 17:46 | - | |
| ipig/ | 2024-12-16 16:35 | - | |
| ipip/ | 2025-01-07 05:24 | - | |
| ipkungfu/ | 2020-07-10 14:52 | - | |
| ipmctl/ | 2024-04-22 03:49 | - | |
| ipmitool/ | 2024-12-17 07:23 | - | |
| ipmiutil/ | 2024-04-05 00:45 | - | |
| ipolish/ | 2024-10-31 12:18 | - | |
| ipp-crypto/ | 2024-12-05 01:51 | - | |
| ippl/ | 2021-12-23 15:59 | - | |
| ippsample/ | 2024-04-10 17:50 | - | |
| ipqalc/ | 2024-04-06 06:48 | - | |
| iprange/ | 2020-12-29 15:34 | - | |
| iprint/ | 2018-04-04 02:00 | - | |
| iprutils/ | 2020-07-14 07:44 | - | |
| ips/ | 2023-11-07 09:36 | - | |
| ipsec-tools/ | 2020-07-14 07:44 | - | |
| ipset/ | 2018-11-23 01:28 | - | |
| ipsvd/ | 2025-01-01 16:45 | - | |
| iptables-converter/ | 2024-11-01 01:06 | - | |
| iptables-netflow/ | 2024-12-16 05:51 | - | |
| iptables-optimizer/ | 2016-12-16 10:09 | - | |
| iptables-persistent/ | 2024-07-21 06:06 | - | |
| iptables/ | 2024-02-13 04:48 | - | |
| iptotal/ | 2024-05-09 00:34 | - | |
| iptraf-ng/ | 2020-01-07 07:48 | - | |
| iptstate/ | 2024-12-11 16:40 | - | |
| iptux/ | 2025-02-03 05:17 | - | |
| ipu6-drivers/ | 2024-12-19 22:53 | - | |
| ipu7-drivers/ | 2024-12-19 22:53 | - | |
| iputils/ | 2024-12-13 10:55 | - | |
| ipv6calc/ | 2024-01-12 17:09 | - | |
| ipv6pref/ | 2024-02-17 12:02 | - | |
| ipv6toolkit/ | 2024-04-05 00:45 | - | |
| ipwatchd-gnotify/ | 2020-04-04 06:53 | - | |
| ipwatchd/ | 2024-11-01 01:23 | - | |
| ipxe-precise/ | 2014-11-06 06:53 | - | |
| ipxe/ | 2016-11-03 06:08 | - | |
| ipy/ | 2025-01-29 22:50 | - | |
| ipykernel/ | 2024-12-15 21:46 | - | |
| ipyparallel/ | 2024-10-31 14:01 | - | |
| ipython-genutils/ | 2024-10-31 14:02 | - | |
| ipython/ | 2024-12-20 16:43 | - | |
| ipywidgets/ | 2025-01-06 05:21 | - | |
| iqtree/ | 2024-11-29 23:47 | - | |
| ir.lv2/ | 2024-04-06 06:48 | - | |
| iraf-fitsutil/ | 2024-07-13 00:07 | - | |
| iraf-mscred/ | 2025-01-05 12:23 | - | |
| iraf-rvsao/ | 2024-04-06 06:48 | - | |
| iraf-sptable/ | 2024-04-06 06:48 | - | |
| iraf-st4gem/ | 2024-05-09 05:20 | - | |
| iraf-xdimsum/ | 2024-02-23 04:51 | - | |
| iraf/ | 2024-11-05 10:49 | - | |
| ircd-hybrid/ | 2025-01-09 00:02 | - | |
| ircd-irc2/ | 2025-01-01 19:40 | - | |
| ircd-ircu/ | 2024-11-02 03:02 | - | |
| ircd-ratbox/ | 2018-01-22 00:51 | - | |
| ircii/ | 2025-01-01 02:50 | - | |
| irclog2html/ | 2024-12-08 10:50 | - | |
| ircmarkers/ | 2023-10-28 06:15 | - | |
| ircp-tray/ | 2018-04-04 02:00 | - | |
| iredis/ | 2024-08-01 00:15 | - | |
| iripdb/ | 2016-10-31 06:26 | - | |
| iriverter/ | 2014-10-23 16:08 | - | |
| irker/ | 2024-06-12 11:24 | - | |
| iroffer/ | 2020-04-28 08:23 | - | |
| ironic-inspector/ | 2025-01-21 03:05 | - | |
| ironic-python-agent/ | 2025-01-31 23:10 | - | |
| ironic-tempest-plugin/ | 2024-12-20 22:48 | - | |
| ironic-ui/ | 2025-01-21 09:37 | - | |
| ironic/ | 2025-01-18 07:56 | - | |
| ironseed/ | 2024-10-31 14:59 | - | |
| irony-mode/ | 2024-11-01 02:53 | - | |
| irrlicht/ | 2024-04-06 06:48 | - | |
| irsim/ | 2024-11-20 10:49 | - | |
| irssi-plugin-otr/ | 2020-07-13 01:50 | - | |
| irssi-plugin-robustirc/ | 2020-07-10 14:52 | - | |
| irssi-plugin-xmpp/ | 2024-04-06 06:48 | - | |
| irssi-scripts/ | 2023-11-05 03:39 | - | |
| irssi/ | 2024-10-20 05:10 | - | |
| irstlm/ | 2024-12-02 15:31 | - | |
| irtt/ | 2024-11-07 23:01 | - | |
| isa-support/ | 2024-11-19 22:38 | - | |
| isakmpd/ | 2022-07-23 20:42 | - | |
| isatapd/ | 2020-08-19 10:50 | - | |
| isbg/ | 2024-12-25 23:11 | - | |
| isbnlib/ | 2024-05-25 10:54 | - | |
| isc-dhcp/ | 2024-04-24 05:57 | - | |
| isc-kea/ | 2024-01-10 23:31 | - | |
| iscpy/ | 2020-01-15 04:48 | - | |
| iscsitarget/ | 2019-01-29 04:30 | - | |
| isdnutils/ | 2020-12-29 15:34 | - | |
| iselect/ | 2024-11-18 04:17 | - | |
| isenkram/ | 2025-01-18 04:53 | - | |
| isl-0.18/ | 2018-03-16 17:17 | - | |
| islamic-menus/ | 2020-01-27 15:23 | - | |
| ismobilejs/ | 2024-01-10 23:31 | - | |
| ismrmrd/ | 2025-01-26 04:49 | - | |
| isns/ | 2016-10-31 18:15 | - | |
| iso-flags-svg/ | 2023-01-02 15:44 | - | |
| isochron/ | 2022-08-03 16:55 | - | |
| isodate/ | 2024-10-31 14:02 | - | |
| isoimagewriter/ | 2025-02-06 15:18 | - | |
| isomaster/ | 2022-03-09 15:14 | - | |
| isomd5sum/ | 2024-11-13 02:24 | - | |
| isoqlog/ | 2020-12-16 21:45 | - | |
| isoquery/ | 2024-08-02 15:01 | - | |
| isorelax/ | 2022-11-05 21:04 | - | |
| isort/ | 2025-02-05 10:52 | - | |
| isospec/ | 2025-01-03 22:08 | - | |
| ispc/ | 2024-12-24 22:43 | - | |
| ispell-czech/ | 2024-12-31 11:17 | - | |
| ispell-et/ | 2022-07-23 20:42 | - | |
| ispell-fo/ | 2023-10-26 10:35 | - | |
| ispell-gl/ | 2022-07-23 20:42 | - | |
| ispell-lt/ | 2024-01-10 17:10 | - | |
| ispell-tl/ | 2022-08-03 16:54 | - | |
| ispell-uk/ | 2022-07-23 20:42 | - | |
| ispell.pt/ | 2022-07-23 20:42 | - | |
| ispell/ | 2024-01-10 22:00 | - | |
| isrcsubmit/ | 2024-10-31 14:02 | - | |
| isso/ | 2022-07-23 20:42 | - | |
| istack-commons/ | 2021-02-09 21:18 | - | |
| istanbul/ | 2018-01-22 00:51 | - | |
| istgt/ | 2024-04-05 00:45 | - | |
| isync/ | 2025-01-20 11:06 | - | |
| italc/ | 2020-10-08 06:18 | - | |
| itamae/ | 2023-10-26 15:13 | - | |
| itango/ | 2024-11-10 16:42 | - | |
| itcl3/ | 2025-01-09 01:16 | - | |
| itcl4/ | 2024-12-09 23:06 | - | |
| itinerary/ | 2024-11-07 05:41 | - | |
| itk3/ | 2024-07-28 11:05 | - | |
| itk4/ | 2024-04-22 09:59 | - | |
| itkadaptivedenoising/ | 2024-11-01 01:06 | - | |
| itkgenericlabelinterpolator/ | 2024-11-01 01:06 | - | |
| itksnap/ | 2022-07-23 20:42 | - | |
| itools/ | 2023-06-04 06:29 | - | |
| itop/ | 2023-08-09 20:50 | - | |
| its-playback-time/ | 2020-12-29 15:34 | - | |
| its/ | 2022-07-23 20:42 | - | |
| itsol/ | 2024-04-22 09:59 | - | |
| itstool/ | 2024-05-23 17:15 | - | |
| itypes/ | 2021-11-29 15:34 | - | |
| iulib/ | 2018-01-22 00:51 | - | |
| iva/ | 2024-12-05 00:01 | - | |
| ivar/ | 2024-12-20 13:51 | - | |
| iverilog/ | 2024-04-04 12:15 | - | |
| ivsc-driver/ | 2024-07-05 07:15 | - | |
| ivtools/ | 2024-12-17 01:22 | - | |
| ivy-debian-helper/ | 2021-01-18 04:17 | - | |
| ivy/ | 2024-01-05 15:35 | - | |
| ivykis/ | 2024-07-25 18:09 | - | |
| ivyplusplus/ | 2024-10-31 14:02 | - | |
| iwatch/ | 2024-05-31 23:51 | - | |
| iwd/ | 2024-04-06 06:48 | - | |
| iwgtk/ | 2024-05-09 05:20 | - | |
| iwidgets4/ | 2021-01-01 21:31 | - | |
| iwyu/ | 2024-11-16 18:40 | - | |
| ixo-usb-jtag/ | 2024-04-02 00:06 | - | |
